C22H27Cl3N2O2S — CID 153368175
1-[4-[2-[3,5-dichloro-4-(3-chloropropylamino)phenyl]propan-2-yl]phenoxy]-3-(methylsulfanylamino)propan-2-one (PubChem CID 153368175) has the molecular formula C22H27Cl3N2O2S and a molecular weight of 489.90 g/mol. Its IUPAC name is 1-[4-[2-[3,5-dichloro-4-(3-chloropropylamino)phenyl]propan-2-yl]phenoxy]-3-(methylsulfanylamino)propan-2-one.
| Compound Name | 1-[4-[2-[3,5-dichloro-4-(3-chloropropylamino)phenyl]propan-2-yl]phenoxy]-3-(methylsulfanylamino)propan-2-one |
|---|---|
| PubChem CID | 153368175 |
| Molecular Formula | C22H27Cl3N2O2S |
| Molecular Weight | 489.90 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 1-[4-[2-[3,5-dichloro-4-(3-chloropropylamino)phenyl]propan-2-yl]phenoxy]-3-(methylsulfanylamino)propan-2-one |
| SMILES | CSNCC(=O)COc1ccc(C(C)(C)c2cc(Cl)c(NCCCCl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H27Cl3N2O2S/c1-22(2,16-11-19(24)21(20(25)12-16)26-10-4-9-23)15-5-7-18(8-6-15)29-14-17(28)13-27-30-3/h5-8,11-12,26-27H,4,9-10,13-14H2,1-3H3 |
| InChIKey | JNIFLVIQRIOKKR-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.90 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|