C23H27ClN2O3S — CID 153368156
5-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]-2-[3-(methylsulfanylamino)-2-oxopropoxy]benzonitrile (PubChem CID 153368156) has the molecular formula C23H27ClN2O3S and a molecular weight of 447.00 g/mol. Its IUPAC name is 5-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]-2-[3-(methylsulfanylamino)-2-oxopropoxy]benzonitrile.
| Compound Name | 5-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]-2-[3-(methylsulfanylamino)-2-oxopropoxy]benzonitrile |
|---|---|
| PubChem CID | 153368156 |
| Molecular Formula | C23H27ClN2O3S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 5-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]-2-[3-(methylsulfanylamino)-2-oxopropoxy]benzonitrile |
| SMILES | CSNCC(=O)COc1ccc(C(C)(C)c2ccc(OCCCCl)cc2)cc1C#N |
| InChI | InChI=1S/C23H27ClN2O3S/c1-23(2,18-5-8-21(9-6-18)28-12-4-11-24)19-7-10-22(17(13-19)14-25)29-16-20(27)15-26-30-3/h5-10,13,26H,4,11-12,15-16H2,1-3H3 |
| InChIKey | UJBOWMWAXMIRQW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|