C22H23Cl3N2O4S — CID 146520305
2,6-dichloro-N-(2-chloroethyl)-4-[2-[4-[(4-methylsulfonyl-1,3-oxazol-5-yl)methoxy]phenyl]propan-2-yl]aniline (PubChem CID 146520305) has the molecular formula C22H23Cl3N2O4S and a molecular weight of 517.86 g/mol. Its IUPAC name is 2,6-dichloro-N-(2-chloroethyl)-4-[2-[4-[(4-methylsulfonyl-1,3-oxazol-5-yl)methoxy]phenyl]propan-2-yl]aniline.
| Compound Name | 2,6-dichloro-N-(2-chloroethyl)-4-[2-[4-[(4-methylsulfonyl-1,3-oxazol-5-yl)methoxy]phenyl]propan-2-yl]aniline |
|---|---|
| PubChem CID | 146520305 |
| Molecular Formula | C22H23Cl3N2O4S |
| Molecular Weight | 517.86 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 2,6-dichloro-N-(2-chloroethyl)-4-[2-[4-[(4-methylsulfonyl-1,3-oxazol-5-yl)methoxy]phenyl]propan-2-yl]aniline |
| SMILES | CC(C)(c1ccc(OCc2ocnc2S(C)(=O)=O)cc1)c1cc(Cl)c(NCCCl)c(Cl)c1 |
| InChI | InChI=1S/C22H23Cl3N2O4S/c1-22(2,15-10-17(24)20(18(25)11-15)26-9-8-23)14-4-6-16(7-5-14)30-12-19-21(27-13-31-19)32(3,28)29/h4-7,10-11,13,26H,8-9,12H2,1-3H3 |
| InChIKey | WGEYYSADKLXGSF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.86 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|