C23H32ClFO4 — CID 144801589
3-[4-[2-[4-(3-chloropropoxy)-3-fluorophenyl]propan-2-yl]phenoxy]propane-1,2-diol;ethane (PubChem CID 144801589) has the molecular formula C23H32ClFO4 and a molecular weight of 426.96 g/mol. Its IUPAC name is 3-[4-[2-[4-(3-chloropropoxy)-3-fluorophenyl]propan-2-yl]phenoxy]propane-1,2-diol;ethane.
| Compound Name | 3-[4-[2-[4-(3-chloropropoxy)-3-fluorophenyl]propan-2-yl]phenoxy]propane-1,2-diol;ethane |
|---|---|
| PubChem CID | 144801589 |
| Molecular Formula | C23H32ClFO4 |
| Molecular Weight | 426.96 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 3-[4-[2-[4-(3-chloropropoxy)-3-fluorophenyl]propan-2-yl]phenoxy]propane-1,2-diol;ethane |
| SMILES | CC.CC(C)(c1ccc(OCC(O)CO)cc1)c1ccc(OCCCCl)c(F)c1 |
| InChI | InChI=1S/C21H26ClFO4.C2H6/c1-21(2,15-4-7-18(8-5-15)27-14-17(25)13-24)16-6-9-20(19(23)12-16)26-11-3-10-22;1-2/h4-9,12,17,24-25H,3,10-11,13-14H2,1-2H3;1-2H3 |
| InChIKey | HERPCYBDYRKIQB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.96 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|