C22H33ClO5S2 — CID 158118472
(2S)-3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]-2-methylphenoxy]propane-1,2-diol;sulfane (PubChem CID 158118472) has the molecular formula C22H33ClO5S2 and a molecular weight of 477.09 g/mol. Its IUPAC name is (2S)-3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]-2-methylphenoxy]propane-1,2-diol;sulfane.
| Compound Name | (2S)-3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]-2-methylphenoxy]propane-1,2-diol;sulfane |
|---|---|
| PubChem CID | 158118472 |
| Molecular Formula | C22H33ClO5S2 |
| Molecular Weight | 477.09 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | (2S)-3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]-2-methylphenoxy]propane-1,2-diol;sulfane |
| SMILES | Cc1cc(C(C)(C)c2ccc(OC[C@H](O)CCl)cc2)ccc1OC[C@@H](O)CO.S.S |
| InChI | InChI=1S/C22H29ClO5.2H2S/c1-15-10-17(6-9-21(15)28-14-19(26)12-24)22(2,3)16-4-7-20(8-5-16)27-13-18(25)11-23;;/h4-10,18-19,24-26H,11-14H2,1-3H3;2*1H2/t18-,19+;;/m1../s1 |
| InChIKey | FRHWBFMKHYRZQC-QNCHGCKQSA-N |
| XLogP | 3.26 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.09 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|