C24H30ClIO6 — CID 144539193
3-[(Z)-3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxyprop-1-enoxy]propyl hypoiodite (PubChem CID 144539193) has the molecular formula C24H30ClIO6 and a molecular weight of 576.86 g/mol. Its IUPAC name is 3-[(Z)-3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxyprop-1-enoxy]propyl hypoiodite.
| Compound Name | 3-[(Z)-3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxyprop-1-enoxy]propyl hypoiodite |
|---|---|
| PubChem CID | 144539193 |
| Molecular Formula | C24H30ClIO6 |
| Molecular Weight | 576.86 g/mol |
| Exact Mass | 576.08 |
| IUPAC Name | 3-[(Z)-3-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxyprop-1-enoxy]propyl hypoiodite |
| SMILES | CC(C)(c1ccc(OC/C(O)=C/OCCCOI)cc1)c1ccc(OC[C@H](O)CCl)cc1 |
| InChI | InChI=1S/C24H30ClIO6/c1-24(2,18-4-8-22(9-5-18)30-16-20(27)14-25)19-6-10-23(11-7-19)31-17-21(28)15-29-12-3-13-32-26/h4-11,15,20,27-28H,3,12-14,16-17H2,1-2H3/b21-15-/t20-/m1/s1 |
| InChIKey | WXUNBGKFICNGFF-YLCCHKQJSA-N |
| XLogP | 5.54 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.86 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|