C25H35ClO6 — CID 159008293
(2R)-1-chloro-3-[4-[2-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]propan-2-yl]phenoxy]-2-methylpropan-2-ol (PubChem CID 159008293) has the molecular formula C25H35ClO6 and a molecular weight of 467.00 g/mol. Its IUPAC name is (2R)-1-chloro-3-[4-[2-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]propan-2-yl]phenoxy]-2-methylpropan-2-ol.
| Compound Name | (2R)-1-chloro-3-[4-[2-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]propan-2-yl]phenoxy]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 159008293 |
| Molecular Formula | C25H35ClO6 |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (2R)-1-chloro-3-[4-[2-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]propan-2-yl]phenoxy]-2-methylpropan-2-ol |
| SMILES | CC(C)(c1ccc(OCCOCCOCCO)cc1)c1ccc(OC[C@@](C)(O)CCl)cc1 |
| InChI | InChI=1S/C25H35ClO6/c1-24(2,21-6-10-23(11-7-21)32-19-25(3,28)18-26)20-4-8-22(9-5-20)31-17-16-30-15-14-29-13-12-27/h4-11,27-28H,12-19H2,1-3H3/t25-/m0/s1 |
| InChIKey | JSERQKBLJBSOPF-VWLOTQADSA-N |
| XLogP | 3.79 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|