C11H26O7 — CID 161004910
2-(2-hydroxyethoxy)ethanol;1-[2-(2-hydroxyethoxy)ethoxy]propan-2-ol (PubChem CID 161004910) has the molecular formula C11H26O7 and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;1-[2-(2-hydroxyethoxy)ethoxy]propan-2-ol.
| Compound Name | 2-(2-hydroxyethoxy)ethanol;1-[2-(2-hydroxyethoxy)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 161004910 |
| Molecular Formula | C11H26O7 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;1-[2-(2-hydroxyethoxy)ethoxy]propan-2-ol |
| SMILES | CC(O)COCCOCCO.OCCOCCO |
| InChI | InChI=1S/C7H16O4.C4H10O3/c1-7(9)6-11-5-4-10-3-2-8;5-1-3-7-4-2-6/h7-9H,2-6H2,1H3;5-6H,1-4H2 |
| InChIKey | TWJLMEWYOUYEFH-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|