C10H22O6 — CID 88655335
1-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-3-methoxypropan-2-ol (PubChem CID 88655335) has the molecular formula C10H22O6 and a molecular weight of 238.28 g/mol. Its IUPAC name is 1-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-3-methoxypropan-2-ol.
| Compound Name | 1-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 88655335 |
| Molecular Formula | C10H22O6 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-3-methoxypropan-2-ol |
| SMILES | COCC(O)COCCOCCOCCO |
| InChI | InChI=1S/C10H22O6/c1-13-8-10(12)9-16-7-6-15-5-4-14-3-2-11/h10-12H,2-9H2,1H3 |
| InChIKey | BUUGXMPYZBPKQG-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|