C16H36O8 — CID 22051748
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]propan-2-ol (PubChem CID 22051748) has the molecular formula C16H36O8 and a molecular weight of 356.46 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]propan-2-ol.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]propan-2-ol |
|---|---|
| PubChem CID | 22051748 |
| Molecular Formula | C16H36O8 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]propan-2-ol |
| SMILES | COCC(C)OCC(C)OCC(C)O.OCCOCCOCCO |
| InChI | InChI=1S/C10H22O4.C6H14O4/c1-8(11)5-13-10(3)7-14-9(2)6-12-4;7-1-3-9-5-6-10-4-2-8/h8-11H,5-7H2,1-4H3;7-8H,1-6H2 |
| InChIKey | FKVKYKOZNFSZIJ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|