C20H44O10 — CID 22051709
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 22051709) has the molecular formula C20H44O10 and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 22051709 |
| Molecular Formula | C20H44O10 |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CC(O)COC(C)COC(C)CO.COCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C11H24O6.C9H20O4/c1-13-4-5-15-8-9-17-11-10-16-7-6-14-3-2-12;1-7(11)5-12-9(3)6-13-8(2)4-10/h12H,2-11H2,1H3;7-11H,4-6H2,1-3H3 |
| InChIKey | QXEZEHZTTZAUBA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|