C19H42O9 — CID 87899229
2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propan-1-ol;2-[2-(2-methoxyethoxy)ethoxy]ethanol (PubChem CID 87899229) has the molecular formula C19H42O9 and a molecular weight of 414.54 g/mol. Its IUPAC name is 2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propan-1-ol;2-[2-(2-methoxyethoxy)ethoxy]ethanol.
| Compound Name | 2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propan-1-ol;2-[2-(2-methoxyethoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 87899229 |
| Molecular Formula | C19H42O9 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propan-1-ol;2-[2-(2-methoxyethoxy)ethoxy]ethanol |
| SMILES | CC(O)COC(C)COC(C)COC(C)CO.COCCOCCOCCO |
| InChI | InChI=1S/C12H26O5.C7H16O4/c1-9(14)6-15-11(3)8-17-12(4)7-16-10(2)5-13;1-9-4-5-11-7-6-10-3-2-8/h9-14H,5-8H2,1-4H3;8H,2-7H2,1H3 |
| InChIKey | FWDOADZFDGUZEG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|