C12H28O6 — CID 175459018
2-(2-hydroxyethoxy)ethanol;1-methoxy-2-(2-methoxypropoxy)propane (PubChem CID 175459018) has the molecular formula C12H28O6 and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;1-methoxy-2-(2-methoxypropoxy)propane.
| Compound Name | 2-(2-hydroxyethoxy)ethanol;1-methoxy-2-(2-methoxypropoxy)propane |
|---|---|
| PubChem CID | 175459018 |
| Molecular Formula | C12H28O6 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;1-methoxy-2-(2-methoxypropoxy)propane |
| SMILES | COCC(C)OCC(C)OC.OCCOCCO |
| InChI | InChI=1S/C8H18O3.C4H10O3/c1-7(10-4)6-11-8(2)5-9-3;5-1-3-7-4-2-6/h7-8H,5-6H2,1-4H3;5-6H,1-4H2 |
| InChIKey | YDFWICZOYLGALH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|