C12H28O5 — CID 161462998
methoxymethane;2-[2-(2-methoxypropoxy)propoxy]propan-1-ol (PubChem CID 161462998) has the molecular formula C12H28O5 and a molecular weight of 252.35 g/mol. Its IUPAC name is methoxymethane;2-[2-(2-methoxypropoxy)propoxy]propan-1-ol.
| Compound Name | methoxymethane;2-[2-(2-methoxypropoxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 161462998 |
| Molecular Formula | C12H28O5 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | methoxymethane;2-[2-(2-methoxypropoxy)propoxy]propan-1-ol |
| SMILES | COC.COC(C)COC(C)COC(C)CO |
| InChI | InChI=1S/C10H22O4.C2H6O/c1-8(5-11)13-7-10(3)14-6-9(2)12-4;1-3-2/h8-11H,5-7H2,1-4H3;1-2H3 |
| InChIKey | WCBHRJBQDMODAY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |