C25H54O5 — CID 173186906
ethane-1,2-diol;ethene;2-(2-methoxypropoxy)propan-1-ol (PubChem CID 173186906) has the molecular formula C25H54O5 and a molecular weight of 434.70 g/mol. Its IUPAC name is ethane-1,2-diol;ethene;2-(2-methoxypropoxy)propan-1-ol.
| Compound Name | ethane-1,2-diol;ethene;2-(2-methoxypropoxy)propan-1-ol |
|---|---|
| PubChem CID | 173186906 |
| Molecular Formula | C25H54O5 |
| Molecular Weight | 434.70 g/mol |
| Exact Mass | 434.40 |
| IUPAC Name | ethane-1,2-diol;ethene;2-(2-methoxypropoxy)propan-1-ol |
| SMILES | C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.COC(C)COC(C)CO.OCCO |
| InChI | InChI=1S/C7H16O3.C2H6O2.8C2H4/c1-6(4-8)10-5-7(2)9-3;3-1-2-4;8*1-2/h6-8H,4-5H2,1-3H3;3-4H,1-2H2;8*1-2H2 |
| InChIKey | LDOAFVWESUTFDL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.70 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|