C10H24O5 — CID 87149453
2-(2-methoxypropoxy)propan-1-ol;propane-1,2-diol (PubChem CID 87149453) has the molecular formula C10H24O5 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-(2-methoxypropoxy)propan-1-ol;propane-1,2-diol.
| Compound Name | 2-(2-methoxypropoxy)propan-1-ol;propane-1,2-diol |
|---|---|
| PubChem CID | 87149453 |
| Molecular Formula | C10H24O5 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-(2-methoxypropoxy)propan-1-ol;propane-1,2-diol |
| SMILES | CC(O)CO.COC(C)COC(C)CO |
| InChI | InChI=1S/C7H16O3.C3H8O2/c1-6(4-8)10-5-7(2)9-3;1-3(5)2-4/h6-8H,4-5H2,1-3H3;3-5H,2H2,1H3 |
| InChIKey | SRLXEGITXWAGGH-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |