C13H28O7 — CID 86606253
2-hydroxypropanoic acid;2-[2-(2-methoxypropoxy)propoxy]propan-1-ol (PubChem CID 86606253) has the molecular formula C13H28O7 and a molecular weight of 296.36 g/mol. Its IUPAC name is 2-hydroxypropanoic acid;2-[2-(2-methoxypropoxy)propoxy]propan-1-ol.
| Compound Name | 2-hydroxypropanoic acid;2-[2-(2-methoxypropoxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 86606253 |
| Molecular Formula | C13H28O7 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-hydroxypropanoic acid;2-[2-(2-methoxypropoxy)propoxy]propan-1-ol |
| SMILES | CC(O)C(=O)O.COC(C)COC(C)COC(C)CO |
| InChI | InChI=1S/C10H22O4.C3H6O3/c1-8(5-11)13-7-10(3)14-6-9(2)12-4;1-2(4)3(5)6/h8-11H,5-7H2,1-4H3;2,4H,1H3,(H,5,6) |
| InChIKey | JFOHBPUYLKJTIE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |