C14H32O6 — CID 158788669
1-methoxy-2-(2-methoxyethoxy)ethane;1-methoxy-2-(2-methoxypropoxy)propane (PubChem CID 158788669) has the molecular formula C14H32O6 and a molecular weight of 296.40 g/mol. Its IUPAC name is 1-methoxy-2-(2-methoxyethoxy)ethane;1-methoxy-2-(2-methoxypropoxy)propane.
| Compound Name | 1-methoxy-2-(2-methoxyethoxy)ethane;1-methoxy-2-(2-methoxypropoxy)propane |
|---|---|
| PubChem CID | 158788669 |
| Molecular Formula | C14H32O6 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 1-methoxy-2-(2-methoxyethoxy)ethane;1-methoxy-2-(2-methoxypropoxy)propane |
| SMILES | COCC(C)OCC(C)OC.COCCOCCOC |
| InChI | InChI=1S/C8H18O3.C6H14O3/c1-7(10-4)6-11-8(2)5-9-3;1-7-3-5-9-6-4-8-2/h7-8H,5-6H2,1-4H3;3-6H2,1-2H3 |
| InChIKey | IRZPPLDKASIQLK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|