C5H12O2Yb — CID 175853617
1,2-dimethoxypropane;ytterbium (PubChem CID 175853617) has the molecular formula C5H12O2Yb and a molecular weight of 277.19 g/mol. Its IUPAC name is 1,2-dimethoxypropane;ytterbium.
| Compound Name | 1,2-dimethoxypropane;ytterbium |
|---|---|
| PubChem CID | 175853617 |
| Molecular Formula | C5H12O2Yb |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 1,2-dimethoxypropane;ytterbium |
| SMILES | COCC(C)OC.[Yb] |
| InChI | InChI=1S/C5H12O2.Yb/c1-5(7-3)4-6-2;/h5H,4H2,1-3H3; |
| InChIKey | PFJGUHHAWBIVAA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |