C8H18O2 — CID 58003999
1,4-dimethoxy-2-methylpentane (PubChem CID 58003999) has the molecular formula C8H18O2 and a molecular weight of 146.23 g/mol. Its IUPAC name is 1,4-dimethoxy-2-methylpentane.
| Compound Name | 1,4-dimethoxy-2-methylpentane |
|---|---|
| PubChem CID | 58003999 |
| Molecular Formula | C8H18O2 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | 1,4-dimethoxy-2-methylpentane |
| SMILES | COCC(C)CC(C)OC |
| InChI | InChI=1S/C8H18O2/c1-7(6-9-3)5-8(2)10-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | GELLJYOLGBCBPK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |