C5H12HoO2 — CID 175853773
1,2-dimethoxypropane;holmium (PubChem CID 175853773) has the molecular formula C5H12HoO2 and a molecular weight of 269.08 g/mol. Its IUPAC name is 1,2-dimethoxypropane;holmium.
| Compound Name | 1,2-dimethoxypropane;holmium |
|---|---|
| PubChem CID | 175853773 |
| Molecular Formula | C5H12HoO2 |
| Molecular Weight | 269.08 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 1,2-dimethoxypropane;holmium |
| SMILES | COCC(C)OC.[Ho] |
| InChI | InChI=1S/C5H12O2.Ho/c1-5(7-3)4-6-2;/h5H,4H2,1-3H3; |
| InChIKey | HOCHWODBAKABML-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.08 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |