C11H26O4 — CID 91039470
1,2-dimethoxybutane;1,2-dimethoxypropane (PubChem CID 91039470) has the molecular formula C11H26O4 and a molecular weight of 222.32 g/mol. Its IUPAC name is 1,2-dimethoxybutane;1,2-dimethoxypropane.
| Compound Name | 1,2-dimethoxybutane;1,2-dimethoxypropane |
|---|---|
| PubChem CID | 91039470 |
| Molecular Formula | C11H26O4 |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 1,2-dimethoxybutane;1,2-dimethoxypropane |
| SMILES | CCC(COC)OC.COCC(C)OC |
| InChI | InChI=1S/C6H14O2.C5H12O2/c1-4-6(8-3)5-7-2;1-5(7-3)4-6-2/h6H,4-5H2,1-3H3;5H,4H2,1-3H3 |
| InChIKey | PJXZZKYXTGLEJT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |