About methane;1-methoxy-2-methylbutane;3-methoxypentane
methane;1-methoxy-2-methylbutane;3-methoxypentane (PubChem CID 160866312) has the molecular formula C18H52O2
and a molecular weight of 300.61 g/mol. Its IUPAC name is methane;1-methoxy-2-methylbutane;3-methoxypentane.
Molecular Properties
| Compound Name | methane;1-methoxy-2-methylbutane;3-methoxypentane |
| PubChem CID | 160866312 |
| Molecular Formula | C18H52O2 |
| Molecular Weight | 300.61 g/mol |
| Exact Mass | 300.40 |
| IUPAC Name | methane;1-methoxy-2-methylbutane;3-methoxypentane |
| SMILES | C.C.C.C.C.C.CCC(C)COC.CCC(CC)OC |
| InChI | InChI=1S/2C6H14O.6CH4/c1-4-6(2)5-7-3;1-4-6(5-2)7-3;;;;;;/h2*6H,4-5H2,1-3H3;6*1H4 |
| InChIKey | SLDVPDYMWYIUIR-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.61 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;1-methoxy-2-methylbutane;3-methoxypentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methoxy-2-methylbutane;3-methoxypentane?
The IUPAC name of methane;1-methoxy-2-methylbutane;3-methoxypentane (CID 160866312) is methane;1-methoxy-2-methylbutane;3-methoxypentane.
What is the SMILES notation for methane;1-methoxy-2-methylbutane;3-methoxypentane?
The canonical SMILES for methane;1-methoxy-2-methylbutane;3-methoxypentane is C.C.C.C.C.C.CCC(C)COC.CCC(CC)OC.
What is the InChIKey of methane;1-methoxy-2-methylbutane;3-methoxypentane?
The InChIKey is SLDVPDYMWYIUIR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H14O.6CH4/c1-4-6(2)5-7-3;1-4-6(5-2)7-3;;;;;;/h2*6H,4-5H2,1-3H3;6*1H4.
What are the key properties of methane;1-methoxy-2-methylbutane;3-methoxypentane?
methane;1-methoxy-2-methylbutane;3-methoxypentane has a molecular weight of 300.61 g/mol, XLogP of 7.32, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methoxy-2-methylbutane;3-methoxypentane is sourced from PubChem (CID 160866312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).