About methane;3-methoxyheptane;1-methoxy-2-methylhexane
methane;3-methoxyheptane;1-methoxy-2-methylhexane (PubChem CID 162176457) has the molecular formula C17H40O2
and a molecular weight of 276.50 g/mol. Its IUPAC name is methane;3-methoxyheptane;1-methoxy-2-methylhexane.
Molecular Properties
| Compound Name | methane;3-methoxyheptane;1-methoxy-2-methylhexane |
| PubChem CID | 162176457 |
| Molecular Formula | C17H40O2 |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.30 |
| IUPAC Name | methane;3-methoxyheptane;1-methoxy-2-methylhexane |
| SMILES | C.CCCCC(C)COC.CCCCC(CC)OC |
| InChI | InChI=1S/2C8H18O.CH4/c1-4-5-6-8(2)7-9-3;1-4-6-7-8(5-2)9-3;/h2*8H,4-7H2,1-3H3;1H4 |
| InChIKey | ZOLOYCQHKQUYTP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;3-methoxyheptane;1-methoxy-2-methylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methoxyheptane;1-methoxy-2-methylhexane?
The IUPAC name of methane;3-methoxyheptane;1-methoxy-2-methylhexane (CID 162176457) is methane;3-methoxyheptane;1-methoxy-2-methylhexane.
What is the SMILES notation for methane;3-methoxyheptane;1-methoxy-2-methylhexane?
The canonical SMILES for methane;3-methoxyheptane;1-methoxy-2-methylhexane is C.CCCCC(C)COC.CCCCC(CC)OC.
What is the InChIKey of methane;3-methoxyheptane;1-methoxy-2-methylhexane?
The InChIKey is ZOLOYCQHKQUYTP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H18O.CH4/c1-4-5-6-8(2)7-9-3;1-4-6-7-8(5-2)9-3;/h2*8H,4-7H2,1-3H3;1H4.
What are the key properties of methane;3-methoxyheptane;1-methoxy-2-methylhexane?
methane;3-methoxyheptane;1-methoxy-2-methylhexane has a molecular weight of 276.50 g/mol, XLogP of 5.70, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methoxyheptane;1-methoxy-2-methylhexane is sourced from PubChem (CID 162176457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).