About methane;1-(2-methoxybutoxy)hexadecane
methane;1-(2-methoxybutoxy)hexadecane (PubChem CID 161162906) has the molecular formula C23H52O2
and a molecular weight of 360.67 g/mol. Its IUPAC name is methane;1-(2-methoxybutoxy)hexadecane.
Molecular Properties
| Compound Name | methane;1-(2-methoxybutoxy)hexadecane |
| PubChem CID | 161162906 |
| Molecular Formula | C23H52O2 |
| Molecular Weight | 360.67 g/mol |
| Exact Mass | 360.40 |
| IUPAC Name | methane;1-(2-methoxybutoxy)hexadecane |
| SMILES | C.C.CCCCCCCCCCCCCCCCOCC(CC)OC |
| InChI | InChI=1S/C21H44O2.2CH4/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-20-21(5-2)22-3;;/h21H,4-20H2,1-3H3;2*1H4 |
| InChIKey | UQDQOPFXVZXEQN-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.67 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;1-(2-methoxybutoxy)hexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-(2-methoxybutoxy)hexadecane?
The IUPAC name of methane;1-(2-methoxybutoxy)hexadecane (CID 161162906) is methane;1-(2-methoxybutoxy)hexadecane.
What is the SMILES notation for methane;1-(2-methoxybutoxy)hexadecane?
The canonical SMILES for methane;1-(2-methoxybutoxy)hexadecane is C.C.CCCCCCCCCCCCCCCCOCC(CC)OC.
What is the InChIKey of methane;1-(2-methoxybutoxy)hexadecane?
The InChIKey is UQDQOPFXVZXEQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O2.2CH4/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-20-21(5-2)22-3;;/h21H,4-20H2,1-3H3;2*1H4.
What are the key properties of methane;1-(2-methoxybutoxy)hexadecane?
methane;1-(2-methoxybutoxy)hexadecane has a molecular weight of 360.67 g/mol, XLogP of 8.18, 19 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-(2-methoxybutoxy)hexadecane is sourced from PubChem (CID 161162906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).