About 1-(2-ethylbutoxy)decane
1-(2-ethylbutoxy)decane (PubChem CID 22002893) has the molecular formula C16H34O
and a molecular weight of 242.45 g/mol. Its IUPAC name is 1-(2-ethylbutoxy)decane.
Molecular Properties
| Compound Name | 1-(2-ethylbutoxy)decane |
| PubChem CID | 22002893 |
| Molecular Formula | C16H34O |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.26 |
| IUPAC Name | 1-(2-ethylbutoxy)decane |
| SMILES | CCCCCCCCCCOCC(CC)CC |
| InChI | InChI=1S/C16H34O/c1-4-7-8-9-10-11-12-13-14-17-15-16(5-2)6-3/h16H,4-15H2,1-3H3 |
| InChIKey | HMHFZSICPHACQI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethylbutoxy)decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethylbutoxy)decane?
The IUPAC name of 1-(2-ethylbutoxy)decane (CID 22002893) is 1-(2-ethylbutoxy)decane.
What is the SMILES notation for 1-(2-ethylbutoxy)decane?
The canonical SMILES for 1-(2-ethylbutoxy)decane is CCCCCCCCCCOCC(CC)CC.
What is the InChIKey of 1-(2-ethylbutoxy)decane?
The InChIKey is HMHFZSICPHACQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O/c1-4-7-8-9-10-11-12-13-14-17-15-16(5-2)6-3/h16H,4-15H2,1-3H3.
What are the key properties of 1-(2-ethylbutoxy)decane?
1-(2-ethylbutoxy)decane has a molecular weight of 242.45 g/mol, XLogP of 5.58, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethylbutoxy)decane is sourced from PubChem (CID 22002893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).