About 3-methoxypentane;1-methoxypropane
3-methoxypentane;1-methoxypropane (PubChem CID 54391478) has the molecular formula C10H24O2
and a molecular weight of 176.30 g/mol. Its IUPAC name is 3-methoxypentane;1-methoxypropane.
Molecular Properties
| Compound Name | 3-methoxypentane;1-methoxypropane |
| PubChem CID | 54391478 |
| Molecular Formula | C10H24O2 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.18 |
| IUPAC Name | 3-methoxypentane;1-methoxypropane |
| SMILES | CCC(CC)OC.CCCOC |
| InChI | InChI=1S/C6H14O.C4H10O/c1-4-6(5-2)7-3;1-3-4-5-2/h6H,4-5H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | VGYKNEOTCNEAFS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxypentane;1-methoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypentane;1-methoxypropane?
The IUPAC name of 3-methoxypentane;1-methoxypropane (CID 54391478) is 3-methoxypentane;1-methoxypropane.
What is the SMILES notation for 3-methoxypentane;1-methoxypropane?
The canonical SMILES for 3-methoxypentane;1-methoxypropane is CCC(CC)OC.CCCOC.
What is the InChIKey of 3-methoxypentane;1-methoxypropane?
The InChIKey is VGYKNEOTCNEAFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C4H10O/c1-4-6(5-2)7-3;1-3-4-5-2/h6H,4-5H2,1-3H3;3-4H2,1-2H3.
What are the key properties of 3-methoxypentane;1-methoxypropane?
3-methoxypentane;1-methoxypropane has a molecular weight of 176.30 g/mol, XLogP of 2.86, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypentane;1-methoxypropane is sourced from PubChem (CID 54391478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).