C10H22O4 — CID 160979574
1,2-dimethoxypropane;ethyl propanoate (PubChem CID 160979574) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1,2-dimethoxypropane;ethyl propanoate.
| Compound Name | 1,2-dimethoxypropane;ethyl propanoate |
|---|---|
| PubChem CID | 160979574 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1,2-dimethoxypropane;ethyl propanoate |
| SMILES | CCOC(=O)CC.COCC(C)OC |
| InChI | InChI=1S/C5H12O2.C5H10O2/c1-5(7-3)4-6-2;1-3-5(6)7-4-2/h5H,4H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | SZIHRECUQXFWGS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |