C12H27NO4 — CID 157049295
(2R)-1-[(2R)-1-[(2R)-1-(2-methoxyethoxy)propan-2-yl]oxypropan-2-yl]oxypropan-2-amine (PubChem CID 157049295) has the molecular formula C12H27NO4 and a molecular weight of 249.35 g/mol. Its IUPAC name is (2R)-1-[(2R)-1-[(2R)-1-(2-methoxyethoxy)propan-2-yl]oxypropan-2-yl]oxypropan-2-amine.
| Compound Name | (2R)-1-[(2R)-1-[(2R)-1-(2-methoxyethoxy)propan-2-yl]oxypropan-2-yl]oxypropan-2-amine |
|---|---|
| PubChem CID | 157049295 |
| Molecular Formula | C12H27NO4 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | (2R)-1-[(2R)-1-[(2R)-1-(2-methoxyethoxy)propan-2-yl]oxypropan-2-yl]oxypropan-2-amine |
| SMILES | COCCOC[C@@H](C)OC[C@@H](C)OC[C@@H](C)N |
| InChI | InChI=1S/C12H27NO4/c1-10(13)7-16-12(3)9-17-11(2)8-15-6-5-14-4/h10-12H,5-9,13H2,1-4H3/t10-,11-,12-/m1/s1 |
| InChIKey | JAVLCTSZYWYEEE-IJLUTSLNSA-N |
| XLogP | 0.81 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|