About 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium
1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium (PubChem CID 159748487) has the molecular formula C13H34N2O3Y
and a molecular weight of 355.33 g/mol. Its IUPAC name is 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium.
Molecular Properties
| Compound Name | 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium |
| PubChem CID | 159748487 |
| Molecular Formula | C13H34N2O3Y |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium |
| SMILES | C.C.CC(N)COCCOC(C)COCC(C)N.[Y] |
| InChI | InChI=1S/C11H26N2O3.2CH4.Y/c1-9(12)6-14-4-5-16-11(3)8-15-7-10(2)13;;;/h9-11H,4-8,12-13H2,1-3H3;2*1H4; |
| InChIKey | NDIVGMYREISXJR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium?
The IUPAC name of 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium (CID 159748487) is 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium.
What is the SMILES notation for 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium?
The canonical SMILES for 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium is C.C.CC(N)COCCOC(C)COCC(C)N.[Y].
What is the InChIKey of 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium?
The InChIKey is NDIVGMYREISXJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2O3.2CH4.Y/c1-9(12)6-14-4-5-16-11(3)8-15-7-10(2)13;;;/h9-11H,4-8,12-13H2,1-3H3;2*1H4;.
What are the key properties of 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium?
1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium has a molecular weight of 355.33 g/mol, XLogP of 1.39, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[1-(2-aminopropoxy)propan-2-yloxy]ethoxy]propan-2-amine;methane;yttrium is sourced from PubChem (CID 159748487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).