C18H41NO8Si — CID 165048221
6-[2-[2-(2-aminopropoxy)ethoxy]propoxy]-5-methyl-1-(3-trihydroxysilylpropoxy)hexan-2-ol (PubChem CID 165048221) has the molecular formula C18H41NO8Si and a molecular weight of 427.61 g/mol. Its IUPAC name is 6-[2-[2-(2-aminopropoxy)ethoxy]propoxy]-5-methyl-1-(3-trihydroxysilylpropoxy)hexan-2-ol.
| Compound Name | 6-[2-[2-(2-aminopropoxy)ethoxy]propoxy]-5-methyl-1-(3-trihydroxysilylpropoxy)hexan-2-ol |
|---|---|
| PubChem CID | 165048221 |
| Molecular Formula | C18H41NO8Si |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 6-[2-[2-(2-aminopropoxy)ethoxy]propoxy]-5-methyl-1-(3-trihydroxysilylpropoxy)hexan-2-ol |
| SMILES | CC(N)COCCOC(C)COCC(C)CCC(O)COCCC[Si](O)(O)O |
| InChI | InChI=1S/C18H41NO8Si/c1-15(5-6-18(20)14-24-7-4-10-28(21,22)23)11-26-13-17(3)27-9-8-25-12-16(2)19/h15-18,20-23H,4-14,19H2,1-3H3 |
| InChIKey | RUGPTJLAGNMSHE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|