C14H36N2O10Si2 — CID 58412214
1-[2-aminoethyl-[2-hydroxy-3-(3-trihydroxysilylpropoxy)propyl]amino]-3-(3-trihydroxysilylpropoxy)propan-2-ol (PubChem CID 58412214) has the molecular formula C14H36N2O10Si2 and a molecular weight of 448.62 g/mol. Its IUPAC name is 1-[2-aminoethyl-[2-hydroxy-3-(3-trihydroxysilylpropoxy)propyl]amino]-3-(3-trihydroxysilylpropoxy)propan-2-ol.
| Compound Name | 1-[2-aminoethyl-[2-hydroxy-3-(3-trihydroxysilylpropoxy)propyl]amino]-3-(3-trihydroxysilylpropoxy)propan-2-ol |
|---|---|
| PubChem CID | 58412214 |
| Molecular Formula | C14H36N2O10Si2 |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 1-[2-aminoethyl-[2-hydroxy-3-(3-trihydroxysilylpropoxy)propyl]amino]-3-(3-trihydroxysilylpropoxy)propan-2-ol |
| SMILES | NCCN(CC(O)COCCC[Si](O)(O)O)CC(O)COCCC[Si](O)(O)O |
| InChI | InChI=1S/C14H36N2O10Si2/c15-3-4-16(9-13(17)11-25-5-1-7-27(19,20)21)10-14(18)12-26-6-2-8-28(22,23)24/h13-14,17-24H,1-12,15H2 |
| InChIKey | BGGCXHIWORBROM-UHFFFAOYSA-N |
| XLogP | -4.39 |
| TPSA | 209.56 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|