C45H96N2O11Si — CID 58412184
1-[6-[bis[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]hexyl-[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]-3-(3-trihydroxysilylpropoxy)propan-2-ol (PubChem CID 58412184) has the molecular formula C45H96N2O11Si and a molecular weight of 869.35 g/mol. Its IUPAC name is 1-[6-[bis[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]hexyl-[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]-3-(3-trihydroxysilylpropoxy)propan-2-ol.
| Compound Name | 1-[6-[bis[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]hexyl-[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]-3-(3-trihydroxysilylpropoxy)propan-2-ol |
|---|---|
| PubChem CID | 58412184 |
| Molecular Formula | C45H96N2O11Si |
| Molecular Weight | 869.35 g/mol |
| Exact Mass | 868.68 |
| IUPAC Name | 1-[6-[bis[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]hexyl-[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]-3-(3-trihydroxysilylpropoxy)propan-2-ol |
| SMILES | CCCCC(CC)COCC(O)CN(CCCCCCN(CC(O)COCC(CC)CCCC)CC(O)COCC(CC)CCCC)CC(O)COCCC[Si](O)(O)O |
| InChI | InChI=1S/C45H96N2O11Si/c1-7-13-21-39(10-4)32-56-36-43(49)29-46(28-42(48)35-55-26-20-27-59(52,53)54)24-18-16-17-19-25-47(30-44(50)37-57-33-40(11-5)22-14-8-2)31-45(51)38-58-34-41(12-6)23-15-9-3/h39-45,48-54H,7-38H2,1-6H3 |
| InChIKey | DGTJHDCEWRQKHC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 185.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 59 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.35 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|