C34H72N2O9S — CID 166750505
3-[3-[6-[bis[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]hexylamino]-2-hydroxypropoxy]propane-1-sulfonic acid (PubChem CID 166750505) has the molecular formula C34H72N2O9S and a molecular weight of 685.02 g/mol. Its IUPAC name is 3-[3-[6-[bis[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]hexylamino]-2-hydroxypropoxy]propane-1-sulfonic acid.
| Compound Name | 3-[3-[6-[bis[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]hexylamino]-2-hydroxypropoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 166750505 |
| Molecular Formula | C34H72N2O9S |
| Molecular Weight | 685.02 g/mol |
| Exact Mass | 684.50 |
| IUPAC Name | 3-[3-[6-[bis[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]hexylamino]-2-hydroxypropoxy]propane-1-sulfonic acid |
| SMILES | CCCCC(CC)COCC(O)CN(CCCCCCNCC(O)COCCCS(=O)(=O)O)CC(O)COCC(CC)CCCC |
| InChI | InChI=1S/C34H72N2O9S/c1-5-9-16-30(7-3)25-44-28-33(38)23-36(24-34(39)29-45-26-31(8-4)17-10-6-2)19-14-12-11-13-18-35-22-32(37)27-43-20-15-21-46(40,41)42/h30-35,37-39H,5-29H2,1-4H3,(H,40,41,42) |
| InChIKey | IMUCOVILXSFGBD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.02 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|