C14H30N2O4 — CID 83209198
2-[[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]ethyl carbamate (PubChem CID 83209198) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-[[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]ethyl carbamate.
| Compound Name | 2-[[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83209198 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-[[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]ethyl carbamate |
| SMILES | CCCCC(CC)COCC(O)CNCCOC(N)=O |
| InChI | InChI=1S/C14H30N2O4/c1-3-5-6-12(4-2)10-19-11-13(17)9-16-7-8-20-14(15)18/h12-13,16-17H,3-11H2,1-2H3,(H2,15,18) |
| InChIKey | QNRYUPQECAYEGS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|