C23H53N2O7Si- — CID 163788234
3-[3-[6-[[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]hexylamino]-2-hydroxypropoxy]propyl-trihydroxysilanuide (PubChem CID 163788234) has the molecular formula C23H53N2O7Si- and a molecular weight of 497.77 g/mol. Its IUPAC name is 3-[3-[6-[[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]hexylamino]-2-hydroxypropoxy]propyl-trihydroxysilanuide.
| Compound Name | 3-[3-[6-[[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]hexylamino]-2-hydroxypropoxy]propyl-trihydroxysilanuide |
|---|---|
| PubChem CID | 163788234 |
| Molecular Formula | C23H53N2O7Si- |
| Molecular Weight | 497.77 g/mol |
| Exact Mass | 497.36 |
| IUPAC Name | 3-[3-[6-[[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]hexylamino]-2-hydroxypropoxy]propyl-trihydroxysilanuide |
| SMILES | CCCCC(CC)COCC(O)CNCCCCCCNCC(O)COCCC[SiH-](O)(O)O |
| InChI | InChI=1S/C23H53N2O7Si/c1-3-5-11-21(4-2)18-32-20-23(27)17-25-13-9-7-6-8-12-24-16-22(26)19-31-14-10-15-33(28,29)30/h21-30,33H,3-20H2,1-2H3/q-1 |
| InChIKey | MUKJTDWFUZHJAH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 143.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.77 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|