C31H73N5O12Si2 — CID 88535985
1-[2-aminoethyl-[2-[2-[2-[bis[2-hydroxy-3-(3-trihydroxysilylpropoxy)propyl]amino]ethylamino]ethylamino]ethyl]amino]-3-(2-ethylhexoxy)propan-2-ol (PubChem CID 88535985) has the molecular formula C31H73N5O12Si2 and a molecular weight of 764.12 g/mol. Its IUPAC name is 1-[2-aminoethyl-[2-[2-[2-[bis[2-hydroxy-3-(3-trihydroxysilylpropoxy)propyl]amino]ethylamino]ethylamino]ethyl]amino]-3-(2-ethylhexoxy)propan-2-ol.
| Compound Name | 1-[2-aminoethyl-[2-[2-[2-[bis[2-hydroxy-3-(3-trihydroxysilylpropoxy)propyl]amino]ethylamino]ethylamino]ethyl]amino]-3-(2-ethylhexoxy)propan-2-ol |
|---|---|
| PubChem CID | 88535985 |
| Molecular Formula | C31H73N5O12Si2 |
| Molecular Weight | 764.12 g/mol |
| Exact Mass | 763.48 |
| IUPAC Name | 1-[2-aminoethyl-[2-[2-[2-[bis[2-hydroxy-3-(3-trihydroxysilylpropoxy)propyl]amino]ethylamino]ethylamino]ethyl]amino]-3-(2-ethylhexoxy)propan-2-ol |
| SMILES | CCCCC(CC)COCC(O)CN(CCN)CCNCCNCCN(CC(O)COCCC[Si](O)(O)O)CC(O)COCCC[Si](O)(O)O |
| InChI | InChI=1S/C31H73N5O12Si2/c1-3-5-8-28(4-2)24-48-27-29(37)21-35(14-9-32)15-12-33-10-11-34-13-16-36(22-30(38)25-46-17-6-19-49(40,41)42)23-31(39)26-47-18-7-20-50(43,44)45/h28-31,33-34,37-45H,3-27,32H2,1-2H3 |
| InChIKey | BSTNQIBRJIQXCP-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 266.32 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.12 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|