C23H52NO8Si- — CID 148726812
3-[3-[[3-(2-ethylhexoxy)-2-hydroxypropyl]-(2-hydroxypropyl)amino]-2-hydroxypropoxy]propyl-trimethoxysilanuide (PubChem CID 148726812) has the molecular formula C23H52NO8Si- and a molecular weight of 498.75 g/mol. Its IUPAC name is 3-[3-[[3-(2-ethylhexoxy)-2-hydroxypropyl]-(2-hydroxypropyl)amino]-2-hydroxypropoxy]propyl-trimethoxysilanuide.
| Compound Name | 3-[3-[[3-(2-ethylhexoxy)-2-hydroxypropyl]-(2-hydroxypropyl)amino]-2-hydroxypropoxy]propyl-trimethoxysilanuide |
|---|---|
| PubChem CID | 148726812 |
| Molecular Formula | C23H52NO8Si- |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | 3-[3-[[3-(2-ethylhexoxy)-2-hydroxypropyl]-(2-hydroxypropyl)amino]-2-hydroxypropoxy]propyl-trimethoxysilanuide |
| SMILES | CCCCC(CC)COCC(O)CN(CC(C)O)CC(O)COCCC[SiH-](OC)(OC)OC |
| InChI | InChI=1S/C23H52NO8Si/c1-7-9-11-21(8-2)17-32-19-23(27)16-24(14-20(3)25)15-22(26)18-31-12-10-13-33(28-4,29-5)30-6/h20-23,25-27,33H,7-19H2,1-6H3/q-1 |
| InChIKey | OAECTKOOZFWMCS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|