C9H23NO6Si — CID 58412169
1-(2-hydroxypropylamino)-3-(3-trihydroxysilylpropoxy)propan-2-ol (PubChem CID 58412169) has the molecular formula C9H23NO6Si and a molecular weight of 269.37 g/mol. Its IUPAC name is 1-(2-hydroxypropylamino)-3-(3-trihydroxysilylpropoxy)propan-2-ol.
| Compound Name | 1-(2-hydroxypropylamino)-3-(3-trihydroxysilylpropoxy)propan-2-ol |
|---|---|
| PubChem CID | 58412169 |
| Molecular Formula | C9H23NO6Si |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 1-(2-hydroxypropylamino)-3-(3-trihydroxysilylpropoxy)propan-2-ol |
| SMILES | CC(O)CNCC(O)COCCC[Si](O)(O)O |
| InChI | InChI=1S/C9H23NO6Si/c1-8(11)5-10-6-9(12)7-16-3-2-4-17(13,14)15/h8-15H,2-7H2,1H3 |
| InChIKey | JVXNEVFTRSJZQB-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|