About 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine
1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine (PubChem CID 159032271) has the molecular formula C13H32N2O3
and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine.
Molecular Properties
| Compound Name | 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine |
| PubChem CID | 159032271 |
| Molecular Formula | C13H32N2O3 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.24 |
| IUPAC Name | 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine |
| SMILES | CCCCCCOCC(C)OCC(C)N.CON |
| InChI | InChI=1S/C12H27NO2.CH5NO/c1-4-5-6-7-8-14-10-12(3)15-9-11(2)13;1-3-2/h11-12H,4-10,13H2,1-3H3;2H2,1H3 |
| InChIKey | JVALOFLOWIUSFD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine?
The IUPAC name of 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine (CID 159032271) is 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine.
What is the SMILES notation for 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine?
The canonical SMILES for 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine is CCCCCCOCC(C)OCC(C)N.CON.
What is the InChIKey of 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine?
The InChIKey is JVALOFLOWIUSFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO2.CH5NO/c1-4-5-6-7-8-14-10-12(3)15-9-11(2)13;1-3-2/h11-12H,4-10,13H2,1-3H3;2H2,1H3.
What are the key properties of 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine?
1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine has a molecular weight of 264.41 g/mol, XLogP of 1.84, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hexoxypropan-2-yloxy)propan-2-amine;O-methylhydroxylamine is sourced from PubChem (CID 159032271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).