About 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol
1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol (PubChem CID 159420422) has the molecular formula C13H30O4
and a molecular weight of 250.38 g/mol. Its IUPAC name is 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol.
Molecular Properties
| Compound Name | 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol |
| PubChem CID | 159420422 |
| Molecular Formula | C13H30O4 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol |
| SMILES | CCC(CC)COCCO.CCOCC(C)O |
| InChI | InChI=1S/C8H18O2.C5H12O2/c1-3-8(4-2)7-10-6-5-9;1-3-7-4-5(2)6/h8-9H,3-7H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | LPRVRMJFFQDSDP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol?
The IUPAC name of 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol (CID 159420422) is 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol.
What is the SMILES notation for 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol?
The canonical SMILES for 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol is CCC(CC)COCCO.CCOCC(C)O.
What is the InChIKey of 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol?
The InChIKey is LPRVRMJFFQDSDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2.C5H12O2/c1-3-8(4-2)7-10-6-5-9;1-3-7-4-5(2)6/h8-9H,3-7H2,1-2H3;5-6H,3-4H2,1-2H3.
What are the key properties of 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol?
1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol has a molecular weight of 250.38 g/mol, XLogP of 1.84, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-2-ol;2-(2-ethylbutoxy)ethanol is sourced from PubChem (CID 159420422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).