About butan-1-ol;1-ethoxypropan-2-ol
butan-1-ol;1-ethoxypropan-2-ol (PubChem CID 158715656) has the molecular formula C9H22O3
and a molecular weight of 178.27 g/mol. Its IUPAC name is butan-1-ol;1-ethoxypropan-2-ol.
Molecular Properties
| Compound Name | butan-1-ol;1-ethoxypropan-2-ol |
| PubChem CID | 158715656 |
| Molecular Formula | C9H22O3 |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.16 |
| IUPAC Name | butan-1-ol;1-ethoxypropan-2-ol |
| SMILES | CCCCO.CCOCC(C)O |
| InChI | InChI=1S/C5H12O2.C4H10O/c1-3-7-4-5(2)6;1-2-3-4-5/h5-6H,3-4H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | IJGUGPJWMINEEP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butan-1-ol;1-ethoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;1-ethoxypropan-2-ol?
The IUPAC name of butan-1-ol;1-ethoxypropan-2-ol (CID 158715656) is butan-1-ol;1-ethoxypropan-2-ol.
What is the SMILES notation for butan-1-ol;1-ethoxypropan-2-ol?
The canonical SMILES for butan-1-ol;1-ethoxypropan-2-ol is CCCCO.CCOCC(C)O.
What is the InChIKey of butan-1-ol;1-ethoxypropan-2-ol?
The InChIKey is IJGUGPJWMINEEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.C4H10O/c1-3-7-4-5(2)6;1-2-3-4-5/h5-6H,3-4H2,1-2H3;5H,2-4H2,1H3.
What are the key properties of butan-1-ol;1-ethoxypropan-2-ol?
butan-1-ol;1-ethoxypropan-2-ol has a molecular weight of 178.27 g/mol, XLogP of 1.18, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;1-ethoxypropan-2-ol is sourced from PubChem (CID 158715656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).