About 1-butoxypropan-2-ol;ethane-1,2-diol;ethene
1-butoxypropan-2-ol;ethane-1,2-diol;ethene (PubChem CID 161226770) has the molecular formula C11H26O4
and a molecular weight of 222.32 g/mol. Its IUPAC name is 1-butoxypropan-2-ol;ethane-1,2-diol;ethene.
Molecular Properties
| Compound Name | 1-butoxypropan-2-ol;ethane-1,2-diol;ethene |
| PubChem CID | 161226770 |
| Molecular Formula | C11H26O4 |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 1-butoxypropan-2-ol;ethane-1,2-diol;ethene |
| SMILES | C=C.CCCCOCC(C)O.OCCO |
| InChI | InChI=1S/C7H16O2.C2H6O2.C2H4/c1-3-4-5-9-6-7(2)8;3-1-2-4;1-2/h7-8H,3-6H2,1-2H3;3-4H,1-2H2;1-2H2 |
| InChIKey | UYFQTGOTFCINID-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxypropan-2-ol;ethane-1,2-diol;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxypropan-2-ol;ethane-1,2-diol;ethene?
The IUPAC name of 1-butoxypropan-2-ol;ethane-1,2-diol;ethene (CID 161226770) is 1-butoxypropan-2-ol;ethane-1,2-diol;ethene.
What is the SMILES notation for 1-butoxypropan-2-ol;ethane-1,2-diol;ethene?
The canonical SMILES for 1-butoxypropan-2-ol;ethane-1,2-diol;ethene is C=C.CCCCOCC(C)O.OCCO.
What is the InChIKey of 1-butoxypropan-2-ol;ethane-1,2-diol;ethene?
The InChIKey is UYFQTGOTFCINID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2.C2H6O2.C2H4/c1-3-4-5-9-6-7(2)8;3-1-2-4;1-2/h7-8H,3-6H2,1-2H3;3-4H,1-2H2;1-2H2.
What are the key properties of 1-butoxypropan-2-ol;ethane-1,2-diol;ethene?
1-butoxypropan-2-ol;ethane-1,2-diol;ethene has a molecular weight of 222.32 g/mol, XLogP of 0.96, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxypropan-2-ol;ethane-1,2-diol;ethene is sourced from PubChem (CID 161226770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).