About 1-butoxypropan-2-ol;1-hexoxypropan-2-ol
1-butoxypropan-2-ol;1-hexoxypropan-2-ol (PubChem CID 158093750) has the molecular formula C16H36O4
and a molecular weight of 292.46 g/mol. Its IUPAC name is 1-butoxypropan-2-ol;1-hexoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-butoxypropan-2-ol;1-hexoxypropan-2-ol |
| PubChem CID | 158093750 |
| Molecular Formula | C16H36O4 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 1-butoxypropan-2-ol;1-hexoxypropan-2-ol |
| SMILES | CCCCCCOCC(C)O.CCCCOCC(C)O |
| InChI | InChI=1S/C9H20O2.C7H16O2/c1-3-4-5-6-7-11-8-9(2)10;1-3-4-5-9-6-7(2)8/h9-10H,3-8H2,1-2H3;7-8H,3-6H2,1-2H3 |
| InChIKey | FOKQDZOWGZGHHR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxypropan-2-ol;1-hexoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxypropan-2-ol;1-hexoxypropan-2-ol?
The IUPAC name of 1-butoxypropan-2-ol;1-hexoxypropan-2-ol (CID 158093750) is 1-butoxypropan-2-ol;1-hexoxypropan-2-ol.
What is the SMILES notation for 1-butoxypropan-2-ol;1-hexoxypropan-2-ol?
The canonical SMILES for 1-butoxypropan-2-ol;1-hexoxypropan-2-ol is CCCCCCOCC(C)O.CCCCOCC(C)O.
What is the InChIKey of 1-butoxypropan-2-ol;1-hexoxypropan-2-ol?
The InChIKey is FOKQDZOWGZGHHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2.C7H16O2/c1-3-4-5-6-7-11-8-9(2)10;1-3-4-5-9-6-7(2)8/h9-10H,3-8H2,1-2H3;7-8H,3-6H2,1-2H3.
What are the key properties of 1-butoxypropan-2-ol;1-hexoxypropan-2-ol?
1-butoxypropan-2-ol;1-hexoxypropan-2-ol has a molecular weight of 292.46 g/mol, XLogP of 3.15, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxypropan-2-ol;1-hexoxypropan-2-ol is sourced from PubChem (CID 158093750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).