About 1-ethoxypropan-2-ol;3-methoxybutan-1-ol
1-ethoxypropan-2-ol;3-methoxybutan-1-ol (PubChem CID 161147161) has the molecular formula C10H24O4
and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-ethoxypropan-2-ol;3-methoxybutan-1-ol.
Molecular Properties
| Compound Name | 1-ethoxypropan-2-ol;3-methoxybutan-1-ol |
| PubChem CID | 161147161 |
| Molecular Formula | C10H24O4 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1-ethoxypropan-2-ol;3-methoxybutan-1-ol |
| SMILES | CCOCC(C)O.COC(C)CCO |
| InChI | InChI=1S/2C5H12O2/c1-5(7-2)3-4-6;1-3-7-4-5(2)6/h2*5-6H,3-4H2,1-2H3 |
| InChIKey | UOEZIMPILMGIAX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethoxypropan-2-ol;3-methoxybutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropan-2-ol;3-methoxybutan-1-ol?
The IUPAC name of 1-ethoxypropan-2-ol;3-methoxybutan-1-ol (CID 161147161) is 1-ethoxypropan-2-ol;3-methoxybutan-1-ol.
What is the SMILES notation for 1-ethoxypropan-2-ol;3-methoxybutan-1-ol?
The canonical SMILES for 1-ethoxypropan-2-ol;3-methoxybutan-1-ol is CCOCC(C)O.COC(C)CCO.
What is the InChIKey of 1-ethoxypropan-2-ol;3-methoxybutan-1-ol?
The InChIKey is UOEZIMPILMGIAX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H12O2/c1-5(7-2)3-4-6;1-3-7-4-5(2)6/h2*5-6H,3-4H2,1-2H3.
What are the key properties of 1-ethoxypropan-2-ol;3-methoxybutan-1-ol?
1-ethoxypropan-2-ol;3-methoxybutan-1-ol has a molecular weight of 208.30 g/mol, XLogP of 0.81, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-2-ol;3-methoxybutan-1-ol is sourced from PubChem (CID 161147161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).