C15H30O9 — CID 88779964
1-ethoxy-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethanol;prop-2-enoic acid (PubChem CID 88779964) has the molecular formula C15H30O9 and a molecular weight of 354.40 g/mol. Its IUPAC name is 1-ethoxy-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethanol;prop-2-enoic acid.
| Compound Name | 1-ethoxy-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethanol;prop-2-enoic acid |
|---|---|
| PubChem CID | 88779964 |
| Molecular Formula | C15H30O9 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-ethoxy-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethanol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCOC(O)COCCOCCOCCOCCO |
| InChI | InChI=1S/C12H26O7.C3H4O2/c1-2-19-12(14)11-18-10-9-17-8-7-16-6-5-15-4-3-13;1-2-3(4)5/h12-14H,2-11H2,1H3;2H,1H2,(H,4,5) |
| InChIKey | BXPPRGNMONDMBI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|