C9H18O5 — CID 87077863
1-(2-hydroxyethoxy)butan-2-ol;prop-2-enoic acid (PubChem CID 87077863) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-(2-hydroxyethoxy)butan-2-ol;prop-2-enoic acid.
| Compound Name | 1-(2-hydroxyethoxy)butan-2-ol;prop-2-enoic acid |
|---|---|
| PubChem CID | 87077863 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 1-(2-hydroxyethoxy)butan-2-ol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCC(O)COCCO |
| InChI | InChI=1S/C6H14O3.C3H4O2/c1-2-6(8)5-9-4-3-7;1-2-3(4)5/h6-8H,2-5H2,1H3;2H,1H2,(H,4,5) |
| InChIKey | IMPRSCUWYGENLJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|