C6H20O11P2 — CID 175300111
1-(2-hydroxyethoxy)butan-2-ol;phosphoric acid (PubChem CID 175300111) has the molecular formula C6H20O11P2 and a molecular weight of 330.16 g/mol. Its IUPAC name is 1-(2-hydroxyethoxy)butan-2-ol;phosphoric acid.
| Compound Name | 1-(2-hydroxyethoxy)butan-2-ol;phosphoric acid |
|---|---|
| PubChem CID | 175300111 |
| Molecular Formula | C6H20O11P2 |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 1-(2-hydroxyethoxy)butan-2-ol;phosphoric acid |
| SMILES | CCC(O)COCCO.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C6H14O3.2H3O4P/c1-2-6(8)5-9-4-3-7;2*1-5(2,3)4/h6-8H,2-5H2,1H3;2*(H3,1,2,3,4) |
| InChIKey | WRJVSBSKRFVDSD-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 205.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|