C9H17F2O6P — CID 175359209
difluorophosphinic acid;1-[2-(2-hydroxyethoxy)ethoxy]pent-4-yn-2-ol (PubChem CID 175359209) has the molecular formula C9H17F2O6P and a molecular weight of 290.20 g/mol. Its IUPAC name is difluorophosphinic acid;1-[2-(2-hydroxyethoxy)ethoxy]pent-4-yn-2-ol.
| Compound Name | difluorophosphinic acid;1-[2-(2-hydroxyethoxy)ethoxy]pent-4-yn-2-ol |
|---|---|
| PubChem CID | 175359209 |
| Molecular Formula | C9H17F2O6P |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | difluorophosphinic acid;1-[2-(2-hydroxyethoxy)ethoxy]pent-4-yn-2-ol |
| SMILES | C#CCC(O)COCCOCCO.O=P(O)(F)F |
| InChI | InChI=1S/C9H16O4.F2HO2P/c1-2-3-9(11)8-13-7-6-12-5-4-10;1-5(2,3)4/h1,9-11H,3-8H2;(H,3,4) |
| InChIKey | PBQVHVCPNUZMJZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|