About difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol
difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol (PubChem CID 175359207) has the molecular formula C9H17F2O5P
and a molecular weight of 274.20 g/mol. Its IUPAC name is difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol.
Molecular Properties
| Compound Name | difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol |
| PubChem CID | 175359207 |
| Molecular Formula | C9H17F2O5P |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol |
| SMILES | C#CCC(O)C(C)(C)OCCO.O=P(O)(F)F |
| InChI | InChI=1S/C9H16O3.F2HO2P/c1-4-5-8(11)9(2,3)12-7-6-10;1-5(2,3)4/h1,8,10-11H,5-7H2,2-3H3;(H,3,4) |
| InChIKey | VVZAZCJFRAEQBS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol?
The IUPAC name of difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol (CID 175359207) is difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol.
What is the SMILES notation for difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol?
The canonical SMILES for difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol is C#CCC(O)C(C)(C)OCCO.O=P(O)(F)F.
What is the InChIKey of difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol?
The InChIKey is VVZAZCJFRAEQBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3.F2HO2P/c1-4-5-8(11)9(2,3)12-7-6-10;1-5(2,3)4/h1,8,10-11H,5-7H2,2-3H3;(H,3,4).
What are the key properties of difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol?
difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol has a molecular weight of 274.20 g/mol, XLogP of 1.18, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for difluorophosphinic acid;2-(2-hydroxyethoxy)-2-methylhex-5-yn-3-ol is sourced from PubChem (CID 175359207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).